C48H55N3O4S2 — CID 67962214
(E)-2-cyano-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid (PubChem CID 67962214) has the molecular formula C48H55N3O4S2 and a molecular weight of 802.12 g/mol. Its IUPAC name is (E)-2-cyano-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67962214 |
| Molecular Formula | C48H55N3O4S2 |
| Molecular Weight | 802.12 g/mol |
| Exact Mass | 801.36 |
| IUPAC Name | (E)-2-cyano-3-[10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3cc4c(s3)c3sc(/C=C(\C#N)C(=O)O)cc3n4CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C48H55N3O4S2/c1-4-7-10-13-28-50-43-32-42(31-36(34-49)48(52)53)56-46(43)47-44(50)33-45(57-47)35-16-18-37(19-17-35)51(38-20-24-40(25-21-38)54-29-14-11-8-5-2)39-22-26-41(27-23-39)55-30-15-12-9-6-3/h16-27,31-33H,4-15,28-30H2,1-3H3,(H,52,53)/b36-31+ |
| InChIKey | PYSMPYMSDQAHOM-XKMRCYARSA-N |
| XLogP | 14.54 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.12 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|