About ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate
ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate (PubChem CID 67962363) has the molecular formula C21H36NO6P
and a molecular weight of 429.49 g/mol. Its IUPAC name is ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate.
Molecular Properties
| Compound Name | ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate |
| PubChem CID | 67962363 |
| Molecular Formula | C21H36NO6P |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate |
| SMILES | Cc1cc(C2CCCCC2)n(OCOP(=O)(OC(C)(C)C)OC(C)(C)C)c(=O)c1 |
| InChI | InChI=1S/C21H36NO6P/c1-16-13-18(17-11-9-8-10-12-17)22(19(23)14-16)25-15-26-29(24,27-20(2,3)4)28-21(5,6)7/h13-14,17H,8-12,15H2,1-7H3 |
| InChIKey | SQSGLQHBAVTKNW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate?
The IUPAC name of ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate (CID 67962363) is ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate.
What is the SMILES notation for ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate?
The canonical SMILES for ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate is Cc1cc(C2CCCCC2)n(OCOP(=O)(OC(C)(C)C)OC(C)(C)C)c(=O)c1.
What is the InChIKey of ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate?
The InChIKey is SQSGLQHBAVTKNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36NO6P/c1-16-13-18(17-11-9-8-10-12-17)22(19(23)14-16)25-15-26-29(24,27-20(2,3)4)28-21(5,6)7/h13-14,17H,8-12,15H2,1-7H3.
What are the key properties of ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate?
ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate has a molecular weight of 429.49 g/mol, XLogP of 5.35, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2-cyclohexyl-4-methyl-6-oxo-1-pyridinyl)oxymethyl phosphate is sourced from PubChem (CID 67962363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).