C27H31N3O5S — CID 67962384
ethyl (5R)-5-[5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)indazol-6-yl]-5-methylsulfonylpent-2-enoate (PubChem CID 67962384) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is ethyl (5R)-5-[5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)indazol-6-yl]-5-methylsulfonylpent-2-enoate.
| Compound Name | ethyl (5R)-5-[5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)indazol-6-yl]-5-methylsulfonylpent-2-enoate |
|---|---|
| PubChem CID | 67962384 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | ethyl (5R)-5-[5-cyclopropyl-3-(methylcarbamoyl)-2-(4-methylphenyl)indazol-6-yl]-5-methylsulfonylpent-2-enoate |
| SMILES | CCOC(=O)C=CC[C@H](c1cc2nn(-c3ccc(C)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C27H31N3O5S/c1-5-35-25(31)8-6-7-24(36(4,33)34)21-16-23-22(15-20(21)18-11-12-18)26(27(32)28-3)30(29-23)19-13-9-17(2)10-14-19/h6,8-10,13-16,18,24H,5,7,11-12H2,1-4H3,(H,28,32)/t24-/m1/s1 |
| InChIKey | ZUDVYSLFKYCXCL-XMMPIXPASA-N |
| XLogP | 4.17 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|