About 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 67962403) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 67962403 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCc1c(C)nc2sccn2c1=O |
| InChI | InChI=1S/C11H14N2OS/c1-3-4-5-9-8(2)12-11-13(10(9)14)6-7-15-11/h6-7H,3-5H2,1-2H3 |
| InChIKey | RGMPJAVSCVMHSD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 67962403) is 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is CCCCc1c(C)nc2sccn2c1=O.
What is the InChIKey of 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is RGMPJAVSCVMHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-3-4-5-9-8(2)12-11-13(10(9)14)6-7-15-11/h6-7H,3-5H2,1-2H3.
What are the key properties of 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 222.31 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 67962403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).