About 4-(4-chlorophenyl)-3,3-difluoropiperidine
4-(4-chlorophenyl)-3,3-difluoropiperidine (PubChem CID 67962435) has the molecular formula C11H12ClF2N
and a molecular weight of 231.67 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-3,3-difluoropiperidine |
| PubChem CID | 67962435 |
| Molecular Formula | C11H12ClF2N |
| Molecular Weight | 231.67 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(4-chlorophenyl)-3,3-difluoropiperidine |
| SMILES | FC1(F)CNCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClF2N/c12-9-3-1-8(2-4-9)10-5-6-15-7-11(10,13)14/h1-4,10,15H,5-7H2 |
| InChIKey | NZRUHIBQAINWQO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-chlorophenyl)-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-3,3-difluoropiperidine?
The IUPAC name of 4-(4-chlorophenyl)-3,3-difluoropiperidine (CID 67962435) is 4-(4-chlorophenyl)-3,3-difluoropiperidine.
What is the SMILES notation for 4-(4-chlorophenyl)-3,3-difluoropiperidine?
The canonical SMILES for 4-(4-chlorophenyl)-3,3-difluoropiperidine is FC1(F)CNCCC1c1ccc(Cl)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-3,3-difluoropiperidine?
The InChIKey is NZRUHIBQAINWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF2N/c12-9-3-1-8(2-4-9)10-5-6-15-7-11(10,13)14/h1-4,10,15H,5-7H2.
What are the key properties of 4-(4-chlorophenyl)-3,3-difluoropiperidine?
4-(4-chlorophenyl)-3,3-difluoropiperidine has a molecular weight of 231.67 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-3,3-difluoropiperidine is sourced from PubChem (CID 67962435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).