About ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate
ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate (PubChem CID 67962604) has the molecular formula C12H13I2NO3
and a molecular weight of 473.05 g/mol. Its IUPAC name is ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate |
| PubChem CID | 67962604 |
| Molecular Formula | C12H13I2NO3 |
| Molecular Weight | 473.05 g/mol |
| Exact Mass | 472.90 |
| IUPAC Name | ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC[C@H]1C(O)(C#CI)C#CI |
| InChI | InChI=1S/C12H13I2NO3/c1-2-18-11(16)15-9-3-4-10(15)12(17,5-7-13)6-8-14/h10,17H,2-4,9H2,1H3/t10-/m0/s1 |
| InChIKey | UZSNQWUGIFTNNB-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.05 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate?
The IUPAC name of ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate (CID 67962604) is ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate.
What is the SMILES notation for ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate?
The canonical SMILES for ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate is CCOC(=O)N1CCC[C@H]1C(O)(C#CI)C#CI.
What is the InChIKey of ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate?
The InChIKey is UZSNQWUGIFTNNB-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13I2NO3/c1-2-18-11(16)15-9-3-4-10(15)12(17,5-7-13)6-8-14/h10,17H,2-4,9H2,1H3/t10-/m0/s1.
What are the key properties of ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate?
ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate has a molecular weight of 473.05 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-(3-hydroxy-1,5-diiodopenta-1,4-diyn-3-yl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 67962604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).