About 3-cyclopropyl-6-methyl-1,2-dihydropyridine
3-cyclopropyl-6-methyl-1,2-dihydropyridine (PubChem CID 67962666) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 3-cyclopropyl-6-methyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 3-cyclopropyl-6-methyl-1,2-dihydropyridine |
| PubChem CID | 67962666 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 3-cyclopropyl-6-methyl-1,2-dihydropyridine |
| SMILES | CC1=CC=C(C2CC2)CN1 |
| InChI | InChI=1S/C9H13N/c1-7-2-3-9(6-10-7)8-4-5-8/h2-3,8,10H,4-6H2,1H3 |
| InChIKey | FJUUHSDNYDNSNA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopropyl-6-methyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-6-methyl-1,2-dihydropyridine?
The IUPAC name of 3-cyclopropyl-6-methyl-1,2-dihydropyridine (CID 67962666) is 3-cyclopropyl-6-methyl-1,2-dihydropyridine.
What is the SMILES notation for 3-cyclopropyl-6-methyl-1,2-dihydropyridine?
The canonical SMILES for 3-cyclopropyl-6-methyl-1,2-dihydropyridine is CC1=CC=C(C2CC2)CN1.
What is the InChIKey of 3-cyclopropyl-6-methyl-1,2-dihydropyridine?
The InChIKey is FJUUHSDNYDNSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-7-2-3-9(6-10-7)8-4-5-8/h2-3,8,10H,4-6H2,1H3.
What are the key properties of 3-cyclopropyl-6-methyl-1,2-dihydropyridine?
3-cyclopropyl-6-methyl-1,2-dihydropyridine has a molecular weight of 135.21 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-6-methyl-1,2-dihydropyridine is sourced from PubChem (CID 67962666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).