About (2-methyl-2,3-dihydrothiophen-5-yl)methanol
(2-methyl-2,3-dihydrothiophen-5-yl)methanol (PubChem CID 67962819) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is (2-methyl-2,3-dihydrothiophen-5-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-2,3-dihydrothiophen-5-yl)methanol |
| PubChem CID | 67962819 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (2-methyl-2,3-dihydrothiophen-5-yl)methanol |
| SMILES | CC1CC=C(CO)S1 |
| InChI | InChI=1S/C6H10OS/c1-5-2-3-6(4-7)8-5/h3,5,7H,2,4H2,1H3 |
| InChIKey | CIMIQYGQDBFFOO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-methyl-2,3-dihydrothiophen-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydrothiophen-5-yl)methanol?
The IUPAC name of (2-methyl-2,3-dihydrothiophen-5-yl)methanol (CID 67962819) is (2-methyl-2,3-dihydrothiophen-5-yl)methanol.
What is the SMILES notation for (2-methyl-2,3-dihydrothiophen-5-yl)methanol?
The canonical SMILES for (2-methyl-2,3-dihydrothiophen-5-yl)methanol is CC1CC=C(CO)S1.
What is the InChIKey of (2-methyl-2,3-dihydrothiophen-5-yl)methanol?
The InChIKey is CIMIQYGQDBFFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-5-2-3-6(4-7)8-5/h3,5,7H,2,4H2,1H3.
What are the key properties of (2-methyl-2,3-dihydrothiophen-5-yl)methanol?
(2-methyl-2,3-dihydrothiophen-5-yl)methanol has a molecular weight of 130.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydrothiophen-5-yl)methanol is sourced from PubChem (CID 67962819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).