C25H24F3N5O2 — CID 67963068
(Z)-3-(3,5-dimethoxyphenyl)-3-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine (PubChem CID 67963068) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is (Z)-3-(3,5-dimethoxyphenyl)-3-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine.
| Compound Name | (Z)-3-(3,5-dimethoxyphenyl)-3-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 67963068 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (Z)-3-(3,5-dimethoxyphenyl)-3-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine |
| SMILES | COc1cc(OC)cc(/C(=C\CNCC(F)(F)F)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1 |
| InChI | InChI=1S/C25H24F3N5O2/c1-33-14-18(12-31-33)24-13-30-22-5-4-16(10-23(22)32-24)21(6-7-29-15-25(26,27)28)17-8-19(34-2)11-20(9-17)35-3/h4-6,8-14,29H,7,15H2,1-3H3/b21-6- |
| InChIKey | AKLROGWAODZNGY-MPUCSWFWSA-N |
| XLogP | 4.63 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|