C21H26O9 — CID 67963097
[(4R,5S)-4,5,6-tris(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate (PubChem CID 67963097) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is [(4R,5S)-4,5,6-tris(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [(4R,5S)-4,5,6-tris(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67963097 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [(4R,5S)-4,5,6-tris(2-methylprop-2-enoyloxy)oxan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1COC(OC(=O)C(=C)C)[C@@H](OC(=O)C(=C)C)[C@@H]1OC(=O)C(=C)C |
| InChI | InChI=1S/C21H26O9/c1-10(2)17(22)27-14-9-26-21(30-20(25)13(7)8)16(29-19(24)12(5)6)15(14)28-18(23)11(3)4/h14-16,21H,1,3,5,7,9H2,2,4,6,8H3/t14?,15-,16+,21?/m1/s1 |
| InChIKey | SDPNMRIVODRFHP-WZHMAMEKSA-N |
| XLogP | 1.93 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|