C20H22FN7O5 — CID 67963424
1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 67963424) has the molecular formula C20H22FN7O5 and a molecular weight of 459.44 g/mol. Its IUPAC name is 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 67963424 |
| Molecular Formula | C20H22FN7O5 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[4-[2-(2-methoxyethoxy)acetyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | COCCOCC(=O)N1CCN(C(=O)C(=O)c2c[nH]c3c(-n4ccnn4)ncc(F)c23)CC1 |
| InChI | InChI=1S/C20H22FN7O5/c1-32-8-9-33-12-15(29)26-4-6-27(7-5-26)20(31)18(30)13-10-22-17-16(13)14(21)11-23-19(17)28-3-2-24-25-28/h2-3,10-11,22H,4-9,12H2,1H3 |
| InChIKey | MKYLPTQJPGLNQJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|