About 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid
5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 67963683) has the molecular formula C17H22N2O6
and a molecular weight of 350.37 g/mol. Its IUPAC name is 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 67963683 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | CCCCOc1cc(-c2cc(C(=O)O)no2)[n+]([O-])cc1OCCCC |
| InChI | InChI=1S/C17H22N2O6/c1-3-5-7-23-15-10-13(14-9-12(17(20)21)18-25-14)19(22)11-16(15)24-8-6-4-2/h9-11H,3-8H2,1-2H3,(H,20,21) |
| InChIKey | LCGWIAREYKUFPJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid (CID 67963683) is 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid is CCCCOc1cc(-c2cc(C(=O)O)no2)[n+]([O-])cc1OCCCC.
What is the InChIKey of 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is LCGWIAREYKUFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O6/c1-3-5-7-23-15-10-13(14-9-12(17(20)21)18-25-14)19(22)11-16(15)24-8-6-4-2/h9-11H,3-8H2,1-2H3,(H,20,21).
What are the key properties of 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid?
5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 350.37 g/mol, XLogP of 3.03, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 67963683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).