About 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one
1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one (PubChem CID 67963946) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one |
| PubChem CID | 67963946 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one |
| SMILES | CCC(C)(C)C(=O)N1C(=O)CC1(C)C |
| InChI | InChI=1S/C11H19NO2/c1-6-10(2,3)9(14)12-8(13)7-11(12,4)5/h6-7H2,1-5H3 |
| InChIKey | HHZQFSHIIRTMBK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one?
The IUPAC name of 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one (CID 67963946) is 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one.
What is the SMILES notation for 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one?
The canonical SMILES for 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one is CCC(C)(C)C(=O)N1C(=O)CC1(C)C.
What is the InChIKey of 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one?
The InChIKey is HHZQFSHIIRTMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-6-10(2,3)9(14)12-8(13)7-11(12,4)5/h6-7H2,1-5H3.
What are the key properties of 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one?
1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one has a molecular weight of 197.28 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylbutanoyl)-4,4-dimethylazetidin-2-one is sourced from PubChem (CID 67963946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).