C17H20F2N4O2 — CID 67964989
[5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanol (PubChem CID 67964989) has the molecular formula C17H20F2N4O2 and a molecular weight of 350.37 g/mol. Its IUPAC name is [5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanol.
| Compound Name | [5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 67964989 |
| Molecular Formula | C17H20F2N4O2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [5-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanol |
| SMILES | N[C@H]1C[C@@H](N2Cc3[nH]nc(CO)c3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C17H20F2N4O2/c18-9-1-2-13(19)11(3-9)17-14(20)4-10(8-25-17)23-5-12-15(6-23)21-22-16(12)7-24/h1-3,10,14,17,24H,4-8,20H2,(H,21,22)/t10-,14+,17-/m1/s1 |
| InChIKey | UKXNMGJLAURFNY-OVWKYPIYSA-N |
| XLogP | 1.35 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |