C18H20F3N5O2 — CID 67964995
2-[5-[(3R,5S)-5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]acetamide (PubChem CID 67964995) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 2-[5-[(3R,5S)-5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]acetamide.
| Compound Name | 2-[5-[(3R,5S)-5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 67964995 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[5-[(3R,5S)-5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1ncc2c1CN([C@H]1COC(c3cc(F)c(F)cc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C18H20F3N5O2/c19-12-3-14(21)13(20)2-11(12)18-15(22)1-10(8-28-18)25-5-9-4-24-26(7-17(23)27)16(9)6-25/h2-4,10,15,18H,1,5-8,22H2,(H2,23,27)/t10-,15+,18?/m1/s1 |
| InChIKey | XBGQDYDWJPTECJ-ZSBPYNMHSA-N |
| XLogP | 0.96 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|