About 6-methyl-1,2-dihydropyridazine-3-carbonitrile
6-methyl-1,2-dihydropyridazine-3-carbonitrile (PubChem CID 67965418) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 6-methyl-1,2-dihydropyridazine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-1,2-dihydropyridazine-3-carbonitrile |
| PubChem CID | 67965418 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 6-methyl-1,2-dihydropyridazine-3-carbonitrile |
| SMILES | CC1=CC=C(C#N)NN1 |
| InChI | InChI=1S/C6H7N3/c1-5-2-3-6(4-7)9-8-5/h2-3,8-9H,1H3 |
| InChIKey | KDMADDBAOBZNEL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1,2-dihydropyridazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,2-dihydropyridazine-3-carbonitrile?
The IUPAC name of 6-methyl-1,2-dihydropyridazine-3-carbonitrile (CID 67965418) is 6-methyl-1,2-dihydropyridazine-3-carbonitrile.
What is the SMILES notation for 6-methyl-1,2-dihydropyridazine-3-carbonitrile?
The canonical SMILES for 6-methyl-1,2-dihydropyridazine-3-carbonitrile is CC1=CC=C(C#N)NN1.
What is the InChIKey of 6-methyl-1,2-dihydropyridazine-3-carbonitrile?
The InChIKey is KDMADDBAOBZNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-5-2-3-6(4-7)9-8-5/h2-3,8-9H,1H3.
What are the key properties of 6-methyl-1,2-dihydropyridazine-3-carbonitrile?
6-methyl-1,2-dihydropyridazine-3-carbonitrile has a molecular weight of 121.14 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,2-dihydropyridazine-3-carbonitrile is sourced from PubChem (CID 67965418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).