C36H20N12O — CID 67965680
2-[2,4,6,7,8-penta(pyrimidin-2-yl)dibenzofuran-3-yl]pyrazine (PubChem CID 67965680) has the molecular formula C36H20N12O and a molecular weight of 636.64 g/mol. Its IUPAC name is 2-[2,4,6,7,8-penta(pyrimidin-2-yl)dibenzofuran-3-yl]pyrazine.
| Compound Name | 2-[2,4,6,7,8-penta(pyrimidin-2-yl)dibenzofuran-3-yl]pyrazine |
|---|---|
| PubChem CID | 67965680 |
| Molecular Formula | C36H20N12O |
| Molecular Weight | 636.64 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | 2-[2,4,6,7,8-penta(pyrimidin-2-yl)dibenzofuran-3-yl]pyrazine |
| SMILES | c1cnc(-c2cc3c(oc4c(-c5ncccn5)c(-c5ncccn5)c(-c5ncccn5)cc43)c(-c3ncccn3)c2-c2cnccn2)nc1 |
| InChI | InChI=1S/C36H20N12O/c1-6-39-32(40-7-1)23-18-21-22-19-24(33-41-8-2-9-42-33)27(34-43-10-3-11-44-34)29(36-47-14-5-15-48-36)31(22)49-30(21)28(35-45-12-4-13-46-35)26(23)25-20-37-16-17-38-25/h1-20H |
| InChIKey | XBVIQRPPXHRJSM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 167.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |