About 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine
7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine (PubChem CID 67965699) has the molecular formula C8H7BrN2O2S
and a molecular weight of 275.13 g/mol. Its IUPAC name is 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine |
| PubChem CID | 67965699 |
| Molecular Formula | C8H7BrN2O2S |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine |
| SMILES | COc1nc(OC)c2scc(Br)c2n1 |
| InChI | InChI=1S/C8H7BrN2O2S/c1-12-7-6-5(4(9)3-14-6)10-8(11-7)13-2/h3H,1-2H3 |
| InChIKey | LMSIPEOBIQQECK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine?
The IUPAC name of 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine (CID 67965699) is 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine.
What is the SMILES notation for 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine?
The canonical SMILES for 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine is COc1nc(OC)c2scc(Br)c2n1.
What is the InChIKey of 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine?
The InChIKey is LMSIPEOBIQQECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O2S/c1-12-7-6-5(4(9)3-14-6)10-8(11-7)13-2/h3H,1-2H3.
What are the key properties of 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine?
7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine has a molecular weight of 275.13 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,4-dimethoxythieno[3,2-d]pyrimidine is sourced from PubChem (CID 67965699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).