C8H14N2O — CID 67965879
1,6-dimethyl-3,4-dihydro-2H-pyridine-2-carboxamide (PubChem CID 67965879) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1,6-dimethyl-3,4-dihydro-2H-pyridine-2-carboxamide.
| Compound Name | 1,6-dimethyl-3,4-dihydro-2H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67965879 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1,6-dimethyl-3,4-dihydro-2H-pyridine-2-carboxamide |
| SMILES | CC1=CCCC(C(N)=O)N1C |
| InChI | InChI=1S/C8H14N2O/c1-6-4-3-5-7(8(9)11)10(6)2/h4,7H,3,5H2,1-2H3,(H2,9,11) |
| InChIKey | NADWPZNPSZHHNR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |