C9H20N2O2S — CID 67966140
N,N,3,4-tetramethylpiperidine-1-sulfonamide (PubChem CID 67966140) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N,N,3,4-tetramethylpiperidine-1-sulfonamide.
| Compound Name | N,N,3,4-tetramethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 67966140 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N,N,3,4-tetramethylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)N(C)C)CC1C |
| InChI | InChI=1S/C9H20N2O2S/c1-8-5-6-11(7-9(8)2)14(12,13)10(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | OLPKLICGLWDQFE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |