C24H23FN4O5S2 — CID 67966387
1-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea (PubChem CID 67966387) has the molecular formula C24H23FN4O5S2 and a molecular weight of 530.60 g/mol. Its IUPAC name is 1-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea.
| Compound Name | 1-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 67966387 |
| Molecular Formula | C24H23FN4O5S2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 1-[4-[1,3-dioxo-6-(propylamino)-4H-isoquinolin-2-yl]-3-fluorophenyl]-3-(5-methylthiophen-2-yl)sulfonylurea |
| SMILES | CCCNc1ccc2c(c1)CC(=O)N(c1ccc(NC(=O)NS(=O)(=O)c3ccc(C)s3)cc1F)C2=O |
| InChI | InChI=1S/C24H23FN4O5S2/c1-3-10-26-16-5-7-18-15(11-16)12-21(30)29(23(18)31)20-8-6-17(13-19(20)25)27-24(32)28-36(33,34)22-9-4-14(2)35-22/h4-9,11,13,26H,3,10,12H2,1-2H3,(H2,27,28,32) |
| InChIKey | FRLUAQDELYKZBP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|