About [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate
[(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 67966414) has the molecular formula C19H17N3O4S
and a molecular weight of 383.43 g/mol. Its IUPAC name is [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate.
Molecular Properties
| Compound Name | [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate |
| PubChem CID | 67966414 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | CC(=O)O[C@H](C(=O)O[C@H](C)c1nnc(-c2ccccn2)s1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O4S/c1-12(17-21-22-18(27-17)15-10-6-7-11-20-15)25-19(24)16(26-13(2)23)14-8-4-3-5-9-14/h3-12,16H,1-2H3/t12-,16+/m1/s1 |
| InChIKey | XUIVXTDXRQLDEL-WBMJQRKESA-N |
| XLogP | 3.51 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate?
The IUPAC name of [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate (CID 67966414) is [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate.
What is the SMILES notation for [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate?
The canonical SMILES for [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate is CC(=O)O[C@H](C(=O)O[C@H](C)c1nnc(-c2ccccn2)s1)c1ccccc1.
What is the InChIKey of [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate?
The InChIKey is XUIVXTDXRQLDEL-WBMJQRKESA-N. The full InChI is InChI=1S/C19H17N3O4S/c1-12(17-21-22-18(27-17)15-10-6-7-11-20-15)25-19(24)16(26-13(2)23)14-8-4-3-5-9-14/h3-12,16H,1-2H3/t12-,16+/m1/s1.
What are the key properties of [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate?
[(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate has a molecular weight of 383.43 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)ethyl] (2S)-2-acetyloxy-2-phenylacetate is sourced from PubChem (CID 67966414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).