About 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile
8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile (PubChem CID 67966558) has the molecular formula C7H4N4O
and a molecular weight of 160.14 g/mol. Its IUPAC name is 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile.
Molecular Properties
| Compound Name | 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile |
| PubChem CID | 67966558 |
| Molecular Formula | C7H4N4O |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile |
| SMILES | N#Cc1c[nH]n2ccnc2c1=O |
| InChI | InChI=1S/C7H4N4O/c8-3-5-4-10-11-2-1-9-7(11)6(5)12/h1-2,4,10H |
| InChIKey | YHBKZUOUABGVKD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile?
The IUPAC name of 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile (CID 67966558) is 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile.
What is the SMILES notation for 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile?
The canonical SMILES for 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile is N#Cc1c[nH]n2ccnc2c1=O.
What is the InChIKey of 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile?
The InChIKey is YHBKZUOUABGVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O/c8-3-5-4-10-11-2-1-9-7(11)6(5)12/h1-2,4,10H.
What are the key properties of 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile?
8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile has a molecular weight of 160.14 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-5H-imidazo[1,2-b]pyridazine-7-carbonitrile is sourced from PubChem (CID 67966558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).