About 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine
5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine (PubChem CID 67966573) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine.
Molecular Properties
| Compound Name | 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine |
| PubChem CID | 67966573 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine |
| SMILES | Cc1cnn2nccc2c1NC1CCCCC1C |
| InChI | InChI=1S/C14H20N4/c1-10-5-3-4-6-12(10)17-14-11(2)9-16-18-13(14)7-8-15-18/h7-10,12,17H,3-6H2,1-2H3 |
| InChIKey | XKQOMRLCNNKQHK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine?
The IUPAC name of 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine (CID 67966573) is 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine.
What is the SMILES notation for 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine?
The canonical SMILES for 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine is Cc1cnn2nccc2c1NC1CCCCC1C.
What is the InChIKey of 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine?
The InChIKey is XKQOMRLCNNKQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4/c1-10-5-3-4-6-12(10)17-14-11(2)9-16-18-13(14)7-8-15-18/h7-10,12,17H,3-6H2,1-2H3.
What are the key properties of 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine?
5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine has a molecular weight of 244.34 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2-methylcyclohexyl)pyrazolo[1,5-b]pyridazin-4-amine is sourced from PubChem (CID 67966573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).