C8H7N5 — CID 67966782
3,5,8,10,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene (PubChem CID 67966782) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 3,5,8,10,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene.
| Compound Name | 3,5,8,10,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene |
|---|---|
| PubChem CID | 67966782 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3,5,8,10,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2(6),3,10,12-pentaene |
| SMILES | c1cc2c(nn1)NCc1[nH]cnc1-2 |
| InChI | InChI=1S/C8H7N5/c1-2-12-13-8-5(1)7-6(3-9-8)10-4-11-7/h1-2,4H,3H2,(H,9,13)(H,10,11) |
| InChIKey | XAFMJRZEBSDPJP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |