C20H20IN3O4 — CID 67966851
(5R)-3-[6-[(3,4-dimethyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]-5-iodo-5-methylimidazolidine-2,4-dione (PubChem CID 67966851) has the molecular formula C20H20IN3O4 and a molecular weight of 493.30 g/mol. Its IUPAC name is (5R)-3-[6-[(3,4-dimethyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]-5-iodo-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[6-[(3,4-dimethyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]-5-iodo-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67966851 |
| Molecular Formula | C20H20IN3O4 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | (5R)-3-[6-[(3,4-dimethyl-3,4-dihydro-2H-chromen-5-yl)oxy]-3-pyridinyl]-5-iodo-5-methylimidazolidine-2,4-dione |
| SMILES | CC1COc2cccc(Oc3ccc(N4C(=O)N[C@](C)(I)C4=O)cn3)c2C1C |
| InChI | InChI=1S/C20H20IN3O4/c1-11-10-27-14-5-4-6-15(17(14)12(11)2)28-16-8-7-13(9-22-16)24-18(25)20(3,21)23-19(24)26/h4-9,11-12H,10H2,1-3H3,(H,23,26)/t11?,12?,20-/m0/s1 |
| InChIKey | FPHIAZRBWFMIOB-IGFCCVMLSA-N |
| XLogP | 4.21 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|