About 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine
6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine (PubChem CID 67967062) has the molecular formula C21H16N6
and a molecular weight of 352.40 g/mol. Its IUPAC name is 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine.
Molecular Properties
| Compound Name | 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine |
| PubChem CID | 67967062 |
| Molecular Formula | C21H16N6 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine |
| SMILES | Nc1ncc2cc(Cc3cnc4ccc(-c5ccccc5)nn34)ccc2n1 |
| InChI | InChI=1S/C21H16N6/c22-21-24-12-16-10-14(6-7-18(16)25-21)11-17-13-23-20-9-8-19(26-27(17)20)15-4-2-1-3-5-15/h1-10,12-13H,11H2,(H2,22,24,25) |
| InChIKey | KDZHRZDLORGFRJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine?
The IUPAC name of 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine (CID 67967062) is 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine.
What is the SMILES notation for 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine?
The canonical SMILES for 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine is Nc1ncc2cc(Cc3cnc4ccc(-c5ccccc5)nn34)ccc2n1.
What is the InChIKey of 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine?
The InChIKey is KDZHRZDLORGFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N6/c22-21-24-12-16-10-14(6-7-18(16)25-21)11-17-13-23-20-9-8-19(26-27(17)20)15-4-2-1-3-5-15/h1-10,12-13H,11H2,(H2,22,24,25).
What are the key properties of 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine?
6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine has a molecular weight of 352.40 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-phenylimidazo[1,2-b]pyridazin-3-yl)methyl]quinazolin-2-amine is sourced from PubChem (CID 67967062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).