C30H42F4O2 — CID 67967248
2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-6-[(4-ethoxy-2,3-difluorophenoxy)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 67967248) has the molecular formula C30H42F4O2 and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-6-[(4-ethoxy-2,3-difluorophenoxy)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-6-[(4-ethoxy-2,3-difluorophenoxy)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 67967248 |
| Molecular Formula | C30H42F4O2 |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-6-[(4-ethoxy-2,3-difluorophenoxy)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCC1CCC(/C(F)=C(\F)C2CCC3CC(COc4ccc(OCC)c(F)c4F)CCC3C2)CC1 |
| InChI | InChI=1S/C30H42F4O2/c1-3-5-19-6-9-21(10-7-19)27(31)28(32)24-13-12-22-16-20(8-11-23(22)17-24)18-36-26-15-14-25(35-4-2)29(33)30(26)34/h14-15,19-24H,3-13,16-18H2,1-2H3/b28-27+ |
| InChIKey | BACPNASMINTZDO-BYYHNAKLSA-N |
| XLogP | 9.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |