About 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole
2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole (PubChem CID 67967752) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole.
Analyze 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole?
The IUPAC name of 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole (CID 67967752) is 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole.
What is the SMILES notation for 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole?
The canonical SMILES for 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole is CC1=CC2CNCC2S1.
What is the InChIKey of 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole?
The InChIKey is YOUJFOGMLHDMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-5-2-6-3-8-4-7(6)9-5/h2,6-8H,3-4H2,1H3.
What are the key properties of 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole?
2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole has a molecular weight of 141.24 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,6a-tetrahydro-3aH-thieno[2,3-c]pyrrole is sourced from PubChem (CID 67967752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).