About (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile
(4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile (PubChem CID 67968118) has the molecular formula C8H8FN
and a molecular weight of 137.16 g/mol. Its IUPAC name is (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 67968118 |
| Molecular Formula | C8H8FN |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile |
| SMILES | C[C@@H]1C=CC(C#N)=C(F)C1 |
| InChI | InChI=1S/C8H8FN/c1-6-2-3-7(5-10)8(9)4-6/h2-3,6H,4H2,1H3/t6-/m1/s1 |
| InChIKey | VXVJZLRZSCYBLV-ZCFIWIBFSA-N |
| XLogP | 2.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile (CID 67968118) is (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile is C[C@@H]1C=CC(C#N)=C(F)C1.
What is the InChIKey of (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is VXVJZLRZSCYBLV-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H8FN/c1-6-2-3-7(5-10)8(9)4-6/h2-3,6H,4H2,1H3/t6-/m1/s1.
What are the key properties of (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile?
(4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 137.16 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-fluoro-4-methylcyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 67968118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).