C20H19BFN3O4 — CID 67968145
[5-(2-fluorobenzoyl)-2-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]boronic acid (PubChem CID 67968145) has the molecular formula C20H19BFN3O4 and a molecular weight of 395.20 g/mol. Its IUPAC name is [5-(2-fluorobenzoyl)-2-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]boronic acid.
| Compound Name | [5-(2-fluorobenzoyl)-2-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]boronic acid |
|---|---|
| PubChem CID | 67968145 |
| Molecular Formula | C20H19BFN3O4 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [5-(2-fluorobenzoyl)-2-(phenoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl]boronic acid |
| SMILES | O=C(c1ccccc1F)N1CCn2nc(COc3ccccc3)c(B(O)O)c2C1 |
| InChI | InChI=1S/C20H19BFN3O4/c22-16-9-5-4-8-15(16)20(26)24-10-11-25-18(12-24)19(21(27)28)17(23-25)13-29-14-6-2-1-3-7-14/h1-9,27-28H,10-13H2 |
| InChIKey | XZNJLRVISKTWCB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|