About 2-fluoro-3,6-dimethylaniline
2-fluoro-3,6-dimethylaniline (PubChem CID 67968158) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is 2-fluoro-3,6-dimethylaniline.
Molecular Properties
| Compound Name | 2-fluoro-3,6-dimethylaniline |
| PubChem CID | 67968158 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 2-fluoro-3,6-dimethylaniline |
| SMILES | Cc1ccc(C)c(F)c1N |
| InChI | InChI=1S/C8H10FN/c1-5-3-4-6(2)8(10)7(5)9/h3-4H,10H2,1-2H3 |
| InChIKey | ARFCSDYGWXHNKP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,6-dimethylaniline?
The IUPAC name of 2-fluoro-3,6-dimethylaniline (CID 67968158) is 2-fluoro-3,6-dimethylaniline.
What is the SMILES notation for 2-fluoro-3,6-dimethylaniline?
The canonical SMILES for 2-fluoro-3,6-dimethylaniline is Cc1ccc(C)c(F)c1N.
What is the InChIKey of 2-fluoro-3,6-dimethylaniline?
The InChIKey is ARFCSDYGWXHNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c1-5-3-4-6(2)8(10)7(5)9/h3-4H,10H2,1-2H3.
What are the key properties of 2-fluoro-3,6-dimethylaniline?
2-fluoro-3,6-dimethylaniline has a molecular weight of 139.17 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,6-dimethylaniline is sourced from PubChem (CID 67968158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).