About 4-(aminomethyl)cyclohexa-1,3-dien-1-amine
4-(aminomethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 67968263) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 4-(aminomethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-(aminomethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 67968263 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 4-(aminomethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | NCC1=CC=C(N)CC1 |
| InChI | InChI=1S/C7H12N2/c8-5-6-1-3-7(9)4-2-6/h1,3H,2,4-5,8-9H2 |
| InChIKey | WOOMKGNBTXLKIE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-(aminomethyl)cyclohexa-1,3-dien-1-amine (CID 67968263) is 4-(aminomethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-(aminomethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-(aminomethyl)cyclohexa-1,3-dien-1-amine is NCC1=CC=C(N)CC1.
What is the InChIKey of 4-(aminomethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is WOOMKGNBTXLKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c8-5-6-1-3-7(9)4-2-6/h1,3H,2,4-5,8-9H2.
What are the key properties of 4-(aminomethyl)cyclohexa-1,3-dien-1-amine?
4-(aminomethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 124.19 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 67968263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).