C14H21N — CID 67968391
N-(2-ethyl-3,3,6-trimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine (PubChem CID 67968391) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-(2-ethyl-3,3,6-trimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine.
| Compound Name | N-(2-ethyl-3,3,6-trimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 67968391 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-(2-ethyl-3,3,6-trimethylcyclohexa-1,5-dien-1-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C1=C(CC)C(C)(C)CC=C1C |
| InChI | InChI=1S/C14H21N/c1-6-10-15-13-11(3)8-9-14(4,5)12(13)7-2/h6,8,10H,1,7,9H2,2-5H3/b15-10+ |
| InChIKey | UDOQBGIZRRXEBH-XNTDXEJSSA-N |
| XLogP | 4.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|