About 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane
5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane (PubChem CID 67968459) has the molecular formula C27H34F2O3
and a molecular weight of 444.56 g/mol. Its IUPAC name is 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane.
Molecular Properties
| Compound Name | 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane |
| PubChem CID | 67968459 |
| Molecular Formula | C27H34F2O3 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane |
| SMILES | CCCc1ccc(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CO3)CO2)cc1 |
| InChI | InChI=1S/C27H34F2O3/c1-3-5-18-6-8-19(9-7-18)23-14-11-21(17-32-23)24-13-10-20(16-31-24)22-12-15-25(30-4-2)27(29)26(22)28/h6-9,12,15,20-21,23-24H,3-5,10-11,13-14,16-17H2,1-2H3 |
| InChIKey | WLZAXFIMSJVWJL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane?
The IUPAC name of 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane (CID 67968459) is 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane.
What is the SMILES notation for 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane?
The canonical SMILES for 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane is CCCc1ccc(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CO3)CO2)cc1.
What is the InChIKey of 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane?
The InChIKey is WLZAXFIMSJVWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34F2O3/c1-3-5-18-6-8-19(9-7-18)23-14-11-21(17-32-23)24-13-10-20(16-31-24)22-12-15-25(30-4-2)27(29)26(22)28/h6-9,12,15,20-21,23-24H,3-5,10-11,13-14,16-17H2,1-2H3.
What are the key properties of 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane?
5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane has a molecular weight of 444.56 g/mol, XLogP of 6.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-propylphenyl)oxan-3-yl]oxane is sourced from PubChem (CID 67968459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).