About 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine
5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine (PubChem CID 67968504) has the molecular formula C29H33F2NO
and a molecular weight of 449.59 g/mol. Its IUPAC name is 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine.
Molecular Properties
| Compound Name | 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine |
| PubChem CID | 67968504 |
| Molecular Formula | C29H33F2NO |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine |
| SMILES | CCCCCc1ccc(C2CCC(c3ccc(-c4ccc(CC)c(F)c4F)cn3)CO2)cc1 |
| InChI | InChI=1S/C29H33F2NO/c1-3-5-6-7-20-8-10-22(11-9-20)27-17-14-24(19-33-27)26-16-13-23(18-32-26)25-15-12-21(4-2)28(30)29(25)31/h8-13,15-16,18,24,27H,3-7,14,17,19H2,1-2H3 |
| InChIKey | VBGHNFQMLSFIHF-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine?
The IUPAC name of 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine (CID 67968504) is 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine.
What is the SMILES notation for 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine?
The canonical SMILES for 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine is CCCCCc1ccc(C2CCC(c3ccc(-c4ccc(CC)c(F)c4F)cn3)CO2)cc1.
What is the InChIKey of 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine?
The InChIKey is VBGHNFQMLSFIHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33F2NO/c1-3-5-6-7-20-8-10-22(11-9-20)27-17-14-24(19-33-27)26-16-13-23(18-32-26)25-15-12-21(4-2)28(30)29(25)31/h8-13,15-16,18,24,27H,3-7,14,17,19H2,1-2H3.
What are the key properties of 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine?
5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine has a molecular weight of 449.59 g/mol, XLogP of 7.96, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethyl-2,3-difluorophenyl)-2-[6-(4-pentylphenyl)oxan-3-yl]pyridine is sourced from PubChem (CID 67968504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).