About 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine
2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine (PubChem CID 67968544) has the molecular formula C27H29F2NO
and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine.
Molecular Properties
| Compound Name | 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine |
| PubChem CID | 67968544 |
| Molecular Formula | C27H29F2NO |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine |
| SMILES | CCCc1ccc(C2CCC(c3ccc(-c4ccc(CC)c(F)c4F)cc3)OC2)nc1 |
| InChI | InChI=1S/C27H29F2NO/c1-3-5-18-6-14-24(30-16-18)22-12-15-25(31-17-22)21-9-7-20(8-10-21)23-13-11-19(4-2)26(28)27(23)29/h6-11,13-14,16,22,25H,3-5,12,15,17H2,1-2H3 |
| InChIKey | IAQFXOMTOKRRGL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine?
The IUPAC name of 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine (CID 67968544) is 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine.
What is the SMILES notation for 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine?
The canonical SMILES for 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine is CCCc1ccc(C2CCC(c3ccc(-c4ccc(CC)c(F)c4F)cc3)OC2)nc1.
What is the InChIKey of 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine?
The InChIKey is IAQFXOMTOKRRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29F2NO/c1-3-5-18-6-14-24(30-16-18)22-12-15-25(31-17-22)21-9-7-20(8-10-21)23-13-11-19(4-2)26(28)27(23)29/h6-11,13-14,16,22,25H,3-5,12,15,17H2,1-2H3.
What are the key properties of 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine?
2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine has a molecular weight of 421.53 g/mol, XLogP of 7.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[4-(4-ethyl-2,3-difluorophenyl)phenyl]oxan-3-yl]-5-propylpyridine is sourced from PubChem (CID 67968544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).