About 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran
4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran (PubChem CID 67968794) has the molecular formula C9H13F3O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran.
Analyze 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran?
The IUPAC name of 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran (CID 67968794) is 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran.
What is the SMILES notation for 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran?
The canonical SMILES for 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran is CC1=C(C)C(C)(C(F)(F)F)CCO1.
What is the InChIKey of 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran?
The InChIKey is SBNHXEHEVBMZRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O/c1-6-7(2)13-5-4-8(6,3)9(10,11)12/h4-5H2,1-3H3.
What are the key properties of 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran?
4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran has a molecular weight of 194.20 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-trimethyl-4-(trifluoromethyl)-2,3-dihydropyran is sourced from PubChem (CID 67968794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).