C45H45NO4 — CID 67968870
13,13-bis(4-methoxyphenyl)-1',1',5',5'-tetramethylspiro[6,12-dioxahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(17),2,7,9,11(16),14,19,21,23-nonaene-18,3'-cyclohexane]-8-amine (PubChem CID 67968870) has the molecular formula C45H45NO4 and a molecular weight of 663.86 g/mol. Its IUPAC name is 13,13-bis(4-methoxyphenyl)-1',1',5',5'-tetramethylspiro[6,12-dioxahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(17),2,7,9,11(16),14,19,21,23-nonaene-18,3'-cyclohexane]-8-amine.
| Compound Name | 13,13-bis(4-methoxyphenyl)-1',1',5',5'-tetramethylspiro[6,12-dioxahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(17),2,7,9,11(16),14,19,21,23-nonaene-18,3'-cyclohexane]-8-amine |
|---|---|
| PubChem CID | 67968870 |
| Molecular Formula | C45H45NO4 |
| Molecular Weight | 663.86 g/mol |
| Exact Mass | 663.33 |
| IUPAC Name | 13,13-bis(4-methoxyphenyl)-1',1',5',5'-tetramethylspiro[6,12-dioxahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(17),2,7,9,11(16),14,19,21,23-nonaene-18,3'-cyclohexane]-8-amine |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c4c(c5c6c(c(N)cc5c3O2)OCC6)-c2ccccc2C42CC(C)(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C45H45NO4/c1-42(2)24-43(3,4)26-44(25-42)35-10-8-7-9-31(35)38-37-32-20-22-49-41(32)36(46)23-34(37)40-33(39(38)44)19-21-45(50-40,27-11-15-29(47-5)16-12-27)28-13-17-30(48-6)18-14-28/h7-19,21,23H,20,22,24-26,46H2,1-6H3 |
| InChIKey | ZWKVZQJARZAPGE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.86 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|