About 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol
4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol (PubChem CID 67968906) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol.
Molecular Properties
| Compound Name | 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol |
| PubChem CID | 67968906 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol |
| SMILES | CC1(C)Cc2c(Br)ccc(O)c2O1 |
| InChI | InChI=1S/C10H11BrO2/c1-10(2)5-6-7(11)3-4-8(12)9(6)13-10/h3-4,12H,5H2,1-2H3 |
| InChIKey | CUKMQQBQOXPLOF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol?
The IUPAC name of 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol (CID 67968906) is 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol.
What is the SMILES notation for 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol?
The canonical SMILES for 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol is CC1(C)Cc2c(Br)ccc(O)c2O1.
What is the InChIKey of 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol?
The InChIKey is CUKMQQBQOXPLOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-10(2)5-6-7(11)3-4-8(12)9(6)13-10/h3-4,12H,5H2,1-2H3.
What are the key properties of 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol?
4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol has a molecular weight of 243.10 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,2-dimethyl-3H-1-benzofuran-7-ol is sourced from PubChem (CID 67968906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).