3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid

C11H16O4 — CID 67969267

IUPAC3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid
SMILESCC(C(=O)O)=C(C)C1CC(C)(C)C(=O)O1
InChIInChI=1S/C11H16O4/c1-6(7(2)9(12)13)8-5-11(3,4)10(14)15-8/h8H,5H2,1-4H3,(H,12,13)
InChIKeyHPMCIRFDNBAYFI-UHFFFAOYSA-N
MW212.24 g/mol
LogP1.75
Rot. Bonds2

About 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid

3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid (PubChem CID 67969267) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid.

Molecular Properties

Compound Name3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid
PubChem CID67969267
Molecular FormulaC11H16O4
Molecular Weight212.24 g/mol
Exact Mass212.10
IUPAC Name3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid
SMILESCC(C(=O)O)=C(C)C1CC(C)(C)C(=O)O1
InChIInChI=1S/C11H16O4/c1-6(7(2)9(12)13)8-5-11(3,4)10(14)15-8/h8H,5H2,1-4H3,(H,12,13)
InChIKeyHPMCIRFDNBAYFI-UHFFFAOYSA-N
XLogP1.75
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.24
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid?
The IUPAC name of 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid (CID 67969267) is 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid.
What is the SMILES notation for 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid?
The canonical SMILES for 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid is CC(C(=O)O)=C(C)C1CC(C)(C)C(=O)O1.
What is the InChIKey of 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid?
The InChIKey is HPMCIRFDNBAYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-6(7(2)9(12)13)8-5-11(3,4)10(14)15-8/h8H,5H2,1-4H3,(H,12,13).
What are the key properties of 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid?
3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid has a molecular weight of 212.24 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethyl-5-oxooxolan-2-yl)-2-methylbut-2-enoic acid is sourced from PubChem (CID 67969267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).