C30H37N3O4Si — CID 67969874
3-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]-6-[[6-(hydroxymethyl)-3-pyridinyl]methyl]benzo[h]quinazolin-4-one (PubChem CID 67969874) has the molecular formula C30H37N3O4Si and a molecular weight of 531.73 g/mol. Its IUPAC name is 3-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]-6-[[6-(hydroxymethyl)-3-pyridinyl]methyl]benzo[h]quinazolin-4-one.
| Compound Name | 3-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]-6-[[6-(hydroxymethyl)-3-pyridinyl]methyl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 67969874 |
| Molecular Formula | C30H37N3O4Si |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 3-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]-6-[[6-(hydroxymethyl)-3-pyridinyl]methyl]benzo[h]quinazolin-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1COCC[C@@H]1n1cnc2c(cc(Cc3ccc(CO)nc3)c3ccccc32)c1=O |
| InChI | InChI=1S/C30H37N3O4Si/c1-30(2,3)38(4,5)37-27-18-36-13-12-26(27)33-19-32-28-24-9-7-6-8-23(24)21(15-25(28)29(33)35)14-20-10-11-22(17-34)31-16-20/h6-11,15-16,19,26-27,34H,12-14,17-18H2,1-5H3/t26-,27-/m0/s1 |
| InChIKey | SNHTVUWACNPJIA-SVBPBHIXSA-N |
| XLogP | 5.38 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|