C20H20FN3O3 — CID 67970433
(1R,4aR,10R,10aR)-8-(2-fluoro-3-pyridinyl)-1-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67970433) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is (1R,4aR,10R,10aR)-8-(2-fluoro-3-pyridinyl)-1-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (1R,4aR,10R,10aR)-8-(2-fluoro-3-pyridinyl)-1-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67970433 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (1R,4aR,10R,10aR)-8-(2-fluoro-3-pyridinyl)-1-methylspiro[3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | C[C@H]1OCC[C@H]2Oc3ccc(-c4cccnc4F)cc3[C@@]3(COC(N)=N3)[C@H]12 |
| InChI | InChI=1S/C20H20FN3O3/c1-11-17-16(6-8-25-11)27-15-5-4-12(13-3-2-7-23-18(13)21)9-14(15)20(17)10-26-19(22)24-20/h2-5,7,9,11,16-17H,6,8,10H2,1H3,(H2,22,24)/t11-,16-,17-,20+/m1/s1 |
| InChIKey | ZYBCWTRDTPBTDB-ZMTUXBBYSA-N |
| XLogP | 2.61 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|