C24H34ClFO2 — CID 67970739
(8S,9S,11S,13S,14S,17R)-2-(5-chloropentyl)-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 67970739) has the molecular formula C24H34ClFO2 and a molecular weight of 408.99 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17R)-2-(5-chloropentyl)-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,17R)-2-(5-chloropentyl)-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 67970739 |
| Molecular Formula | C24H34ClFO2 |
| Molecular Weight | 408.99 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (8S,9S,11S,13S,14S,17R)-2-(5-chloropentyl)-11-fluoro-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](F)[C@@H]3c4cc(CCCCCCl)c(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C24H34ClFO2/c1-23-14-20(26)22-17(19(23)9-10-24(23,2)28)8-7-15-13-21(27)16(12-18(15)22)6-4-3-5-11-25/h12-13,17,19-20,22,27-28H,3-11,14H2,1-2H3/t17-,19-,20-,22-,23-,24+/m0/s1 |
| InChIKey | FRRHFZWYEWEOEZ-JBYPSEEJSA-N |
| XLogP | 5.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|