C15H11Cl2N5OS — CID 67970788
(2,3-dichlorophenyl)-[3-(1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 67970788) has the molecular formula C15H11Cl2N5OS and a molecular weight of 380.26 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[3-(1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (2,3-dichlorophenyl)-[3-(1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 67970788 |
| Molecular Formula | C15H11Cl2N5OS |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (2,3-dichlorophenyl)-[3-(1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCn2c(nnc2-c2cscn2)C1 |
| InChI | InChI=1S/C15H11Cl2N5OS/c16-10-3-1-2-9(13(10)17)15(23)21-4-5-22-12(6-21)19-20-14(22)11-7-24-8-18-11/h1-3,7-8H,4-6H2 |
| InChIKey | XDVOAXOJEKZACL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |