C16H16F2N8O2 — CID 67970827
1-(3-amino-2,6-difluorophenyl)-3-(3-morpholin-4-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea (PubChem CID 67970827) has the molecular formula C16H16F2N8O2 and a molecular weight of 390.35 g/mol. Its IUPAC name is 1-(3-amino-2,6-difluorophenyl)-3-(3-morpholin-4-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea.
| Compound Name | 1-(3-amino-2,6-difluorophenyl)-3-(3-morpholin-4-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 67970827 |
| Molecular Formula | C16H16F2N8O2 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-(3-amino-2,6-difluorophenyl)-3-(3-morpholin-4-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
| SMILES | Nc1ccc(F)c(NC(=O)Nc2ncnc3[nH]nc(N4CCOCC4)c23)c1F |
| InChI | InChI=1S/C16H16F2N8O2/c17-8-1-2-9(19)11(18)12(8)22-16(27)23-13-10-14(21-7-20-13)24-25-15(10)26-3-5-28-6-4-26/h1-2,7H,3-6,19H2,(H3,20,21,22,23,24,25,27) |
| InChIKey | OAXMWJJFBFXNHJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|