C8H7N3O5S — CID 67970968
2-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]but-2-enedioic acid (PubChem CID 67970968) has the molecular formula C8H7N3O5S and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]but-2-enedioic acid.
| Compound Name | 2-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67970968 |
| Molecular Formula | C8H7N3O5S |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]but-2-enedioic acid |
| SMILES | O=C(O)C=C(CC(=O)Nc1nncs1)C(=O)O |
| InChI | InChI=1S/C8H7N3O5S/c12-5(10-8-11-9-3-17-8)1-4(7(15)16)2-6(13)14/h2-3H,1H2,(H,13,14)(H,15,16)(H,10,11,12) |
| InChIKey | NNOLPZIFENXTQL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|