C19H20N4O3 — CID 67970973
(4aS,10R,10aS)-4a-methyl-8-pyrimidin-5-ylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67970973) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (4aS,10R,10aS)-4a-methyl-8-pyrimidin-5-ylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (4aS,10R,10aS)-4a-methyl-8-pyrimidin-5-ylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67970973 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (4aS,10R,10aS)-4a-methyl-8-pyrimidin-5-ylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | C[C@]12CCOC[C@@H]1[C@]1(COC(N)=N1)c1cc(-c3cncnc3)ccc1O2 |
| InChI | InChI=1S/C19H20N4O3/c1-18-4-5-24-9-16(18)19(10-25-17(20)23-19)14-6-12(2-3-15(14)26-18)13-7-21-11-22-8-13/h2-3,6-8,11,16H,4-5,9-10H2,1H3,(H2,20,23)/t16-,18-,19-/m0/s1 |
| InChIKey | ADNNRZBATPWJKB-WDSOQIARSA-N |
| XLogP | 1.87 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |