C16H16F2N8O — CID 67971188
1-(3-amino-2,6-difluorophenyl)-3-(3-pyrrolidin-1-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea (PubChem CID 67971188) has the molecular formula C16H16F2N8O and a molecular weight of 374.36 g/mol. Its IUPAC name is 1-(3-amino-2,6-difluorophenyl)-3-(3-pyrrolidin-1-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea.
| Compound Name | 1-(3-amino-2,6-difluorophenyl)-3-(3-pyrrolidin-1-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 67971188 |
| Molecular Formula | C16H16F2N8O |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-(3-amino-2,6-difluorophenyl)-3-(3-pyrrolidin-1-yl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
| SMILES | Nc1ccc(F)c(NC(=O)Nc2ncnc3[nH]nc(N4CCCC4)c23)c1F |
| InChI | InChI=1S/C16H16F2N8O/c17-8-3-4-9(19)11(18)12(8)22-16(27)23-13-10-14(21-7-20-13)24-25-15(10)26-5-1-2-6-26/h3-4,7H,1-2,5-6,19H2,(H3,20,21,22,23,24,25,27) |
| InChIKey | IPGVOQKXATYIAN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|