About 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole
2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole (PubChem CID 67971280) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole |
| PubChem CID | 67971280 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole |
| SMILES | C1=NCCO1.O=C1CCc2ccccc21 |
| InChI | InChI=1S/C9H8O.C3H5NO/c10-9-6-5-7-3-1-2-4-8(7)9;1-2-5-3-4-1/h1-4H,5-6H2;3H,1-2H2 |
| InChIKey | NOWHDMUAMMWABV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole?
The IUPAC name of 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole (CID 67971280) is 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole is C1=NCCO1.O=C1CCc2ccccc21.
What is the InChIKey of 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole?
The InChIKey is NOWHDMUAMMWABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C3H5NO/c10-9-6-5-7-3-1-2-4-8(7)9;1-2-5-3-4-1/h1-4H,5-6H2;3H,1-2H2.
What are the key properties of 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole?
2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole has a molecular weight of 203.24 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroinden-1-one;4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 67971280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).